N~1~-[2-(4-chlorophenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]-N~2~-cyclohexylethanediamide
Chemical Structure Depiction of
N~1~-[2-(4-chlorophenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]-N~2~-cyclohexylethanediamide
N~1~-[2-(4-chlorophenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]-N~2~-cyclohexylethanediamide
Compound characteristics
| Compound ID: | G857-0826 |
| Compound Name: | N~1~-[2-(4-chlorophenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-yl]-N~2~-cyclohexylethanediamide |
| Molecular Weight: | 404.92 |
| Molecular Formula: | C19 H21 Cl N4 O2 S |
| Smiles: | C1CCC(CC1)NC(C(Nc1c2CSCc2nn1c1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7114 |
| logD: | 2.7051 |
| logSw: | -4.3165 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.04 |
| InChI Key: | LSQGKWPRHXLSHX-UHFFFAOYSA-N |