benzyl [(6-ethyl-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidin-5-yl)sulfanyl]acetate
Chemical Structure Depiction of
benzyl [(6-ethyl-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidin-5-yl)sulfanyl]acetate
benzyl [(6-ethyl-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidin-5-yl)sulfanyl]acetate
Compound characteristics
| Compound ID: | G857-0994 |
| Compound Name: | benzyl [(6-ethyl-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidin-5-yl)sulfanyl]acetate |
| Molecular Weight: | 399.47 |
| Molecular Formula: | C20 H21 N3 O4 S |
| Smiles: | CCc1cnc2c(C(N(C)C(N2C)=O)=O)c1SCC(=O)OCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5172 |
| logD: | 3.5163 |
| logSw: | -3.6672 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 62.025 |
| InChI Key: | TXUOQQHBFVVKLK-UHFFFAOYSA-N |