5-butoxy-2-(4-phenoxy-1H-pyrazol-3-yl)phenol
Chemical Structure Depiction of
5-butoxy-2-(4-phenoxy-1H-pyrazol-3-yl)phenol
5-butoxy-2-(4-phenoxy-1H-pyrazol-3-yl)phenol
Compound characteristics
| Compound ID: | G857-1205 |
| Compound Name: | 5-butoxy-2-(4-phenoxy-1H-pyrazol-3-yl)phenol |
| Molecular Weight: | 324.38 |
| Molecular Formula: | C19 H20 N2 O3 |
| Smiles: | CCCCOc1ccc(c(c1)O)c1c(c[nH]n1)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.2623 |
| logD: | 5.2442 |
| logSw: | -4.8725 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.229 |
| InChI Key: | GEDNDDWNNGLMKA-UHFFFAOYSA-N |