1,1'-[6-(4-tert-butylphenyl)-3-methyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
Chemical Structure Depiction of
1,1'-[6-(4-tert-butylphenyl)-3-methyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
1,1'-[6-(4-tert-butylphenyl)-3-methyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
Compound characteristics
| Compound ID: | G857-1383 |
| Compound Name: | 1,1'-[6-(4-tert-butylphenyl)-3-methyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one) |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C19 H22 N4 O2 S |
| Smiles: | CC(C1=C(c2ccc(cc2)C(C)(C)C)N(C(C)=O)n2c(C)nnc2S1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1676 |
| logD: | 3.1676 |
| logSw: | -3.1406 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.463 |
| InChI Key: | NNCDSCOPTWQOHU-UHFFFAOYSA-N |