1,1'-[6-(3,4-dimethylphenyl)-3-phenyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
Chemical Structure Depiction of
1,1'-[6-(3,4-dimethylphenyl)-3-phenyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
1,1'-[6-(3,4-dimethylphenyl)-3-phenyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one)
Compound characteristics
| Compound ID: | G857-1409 |
| Compound Name: | 1,1'-[6-(3,4-dimethylphenyl)-3-phenyl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5,7-diyl]di(ethan-1-one) |
| Molecular Weight: | 404.49 |
| Molecular Formula: | C22 H20 N4 O2 S |
| Smiles: | CC(C1=C(c2ccc(C)c(C)c2)N(C(C)=O)n2c(c3ccccc3)nnc2S1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2646 |
| logD: | 4.2646 |
| logSw: | -4.3216 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.415 |
| InChI Key: | BMLJLTOVSQUSKN-UHFFFAOYSA-N |