5-[(3-chlorophenyl)(4-methylpiperidin-1-yl)methyl]-2-(furan-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol
Chemical Structure Depiction of
5-[(3-chlorophenyl)(4-methylpiperidin-1-yl)methyl]-2-(furan-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol
5-[(3-chlorophenyl)(4-methylpiperidin-1-yl)methyl]-2-(furan-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol
Compound characteristics
| Compound ID: | G857-1737 |
| Compound Name: | 5-[(3-chlorophenyl)(4-methylpiperidin-1-yl)methyl]-2-(furan-2-yl)[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| Molecular Weight: | 428.94 |
| Molecular Formula: | C21 H21 Cl N4 O2 S |
| Smiles: | CC1CCN(CC1)C(c1cccc(c1)[Cl])c1c(n2c(nc(c3ccco3)n2)s1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6042 |
| logD: | 4.6042 |
| logSw: | -4.4415 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.472 |
| InChI Key: | VQWOSOAJBOVCDV-QGZVFWFLSA-N |