methyl 2-amino-4-(4-chlorophenyl)-6-(2-methoxyethyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-4-(4-chlorophenyl)-6-(2-methoxyethyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
methyl 2-amino-4-(4-chlorophenyl)-6-(2-methoxyethyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate
Compound characteristics
| Compound ID: | G857-1964 |
| Compound Name: | methyl 2-amino-4-(4-chlorophenyl)-6-(2-methoxyethyl)-7-methyl-5-oxo-5,6-dihydro-4H-pyrano[3,2-c]pyridine-3-carboxylate |
| Molecular Weight: | 404.85 |
| Molecular Formula: | C20 H21 Cl N2 O5 |
| Smiles: | CC1=CC2=C(C(C(=C(N)O2)C(=O)OC)c2ccc(cc2)[Cl])C(N1CCOC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2715 |
| logD: | 2.2715 |
| logSw: | -3.4364 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.061 |
| InChI Key: | WTAFULQRYYOPLL-OAHLLOKOSA-N |