2-(4-fluorobenzene-1-sulfonyl)-1-(4-methylphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
Chemical Structure Depiction of
2-(4-fluorobenzene-1-sulfonyl)-1-(4-methylphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
2-(4-fluorobenzene-1-sulfonyl)-1-(4-methylphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine
Compound characteristics
| Compound ID: | G857-2149 |
| Compound Name: | 2-(4-fluorobenzene-1-sulfonyl)-1-(4-methylphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| Molecular Weight: | 370.44 |
| Molecular Formula: | C20 H19 F N2 O2 S |
| Smiles: | Cc1ccc(cc1)C1c2cccn2CCN1S(c1ccc(cc1)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4132 |
| logD: | 4.4132 |
| logSw: | -4.2322 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.2 |
| InChI Key: | PFUHMKBHZQRSJV-HXUWFJFHSA-N |