2-{[(3-chlorophenyl)methyl]sulfanyl}-N-cyclopentyl-3-(3-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[(3-chlorophenyl)methyl]sulfanyl}-N-cyclopentyl-3-(3-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
2-{[(3-chlorophenyl)methyl]sulfanyl}-N-cyclopentyl-3-(3-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0060 |
| Compound Name: | 2-{[(3-chlorophenyl)methyl]sulfanyl}-N-cyclopentyl-3-(3-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 508.01 |
| Molecular Formula: | C27 H23 Cl F N3 O2 S |
| Smiles: | C1CCC(C1)NC(c1ccc2C(N(C(=Nc2c1)SCc1cccc(c1)[Cl])c1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6025 |
| logD: | 5.6025 |
| logSw: | -5.9718 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.664 |
| InChI Key: | ZPLIVDLRLWHWEG-UHFFFAOYSA-N |