3-(3,5-dimethylphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
3-(3,5-dimethylphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
3-(3,5-dimethylphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0141 |
| Compound Name: | 3-(3,5-dimethylphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-N-(propan-2-yl)-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 471.62 |
| Molecular Formula: | C28 H29 N3 O2 S |
| Smiles: | CC(C)NC(c1ccc2C(N(C(=Nc2c1)SCc1cccc(C)c1)c1cc(C)cc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8301 |
| logD: | 5.8292 |
| logSw: | -5.389 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.819 |
| InChI Key: | SPOGECIZFZECMX-UHFFFAOYSA-N |