3-(3,5-dimethylphenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methylpropyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
3-(3,5-dimethylphenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methylpropyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
3-(3,5-dimethylphenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methylpropyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0169 |
| Compound Name: | 3-(3,5-dimethylphenyl)-2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methylpropyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 489.61 |
| Molecular Formula: | C28 H28 F N3 O2 S |
| Smiles: | CC(C)CNC(c1ccc2C(N(C(=Nc2c1)SCc1ccccc1F)c1cc(C)cc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9014 |
| logD: | 5.9005 |
| logSw: | -5.4789 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.844 |
| InChI Key: | RIKNGKVTZVOADI-UHFFFAOYSA-N |