2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methoxyethyl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methoxyethyl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methoxyethyl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0295 |
| Compound Name: | 2-{[(2-fluorophenyl)methyl]sulfanyl}-N-(2-methoxyethyl)-3-(3-methoxyphenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 493.56 |
| Molecular Formula: | C26 H24 F N3 O4 S |
| Smiles: | COCCNC(c1ccc2C(N(C(=Nc2c1)SCc1ccccc1F)c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9376 |
| logD: | 3.9375 |
| logSw: | -4.0758 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.572 |
| InChI Key: | FMMBBIFAUOEWPQ-UHFFFAOYSA-N |