3-(4-fluorophenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-7-(pyrrolidine-1-carbonyl)quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(4-fluorophenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-7-(pyrrolidine-1-carbonyl)quinazolin-4(3H)-one
3-(4-fluorophenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-7-(pyrrolidine-1-carbonyl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | G858-0464 |
| Compound Name: | 3-(4-fluorophenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-7-(pyrrolidine-1-carbonyl)quinazolin-4(3H)-one |
| Molecular Weight: | 473.57 |
| Molecular Formula: | C27 H24 F N3 O2 S |
| Smiles: | Cc1cccc(CSC2=Nc3cc(ccc3C(N2c2ccc(cc2)F)=O)C(N2CCCC2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.7137 |
| logD: | 4.7135 |
| logSw: | -4.475 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.174 |
| InChI Key: | VUAFTQQDOHETSN-UHFFFAOYSA-N |