N-benzyl-3-(4-fluorophenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
N-benzyl-3-(4-fluorophenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
N-benzyl-3-(4-fluorophenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0494 |
| Compound Name: | N-benzyl-3-(4-fluorophenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 523.63 |
| Molecular Formula: | C31 H26 F N3 O2 S |
| Smiles: | Cc1cccc(CSC2=Nc3cc(ccc3C(N2c2ccc(cc2)F)=O)C(N(C)Cc2ccccc2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.8091 |
| logD: | 5.8089 |
| logSw: | -5.4913 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.31 |
| InChI Key: | HIFJRXYZGQHFTC-UHFFFAOYSA-N |