2-{[(2-chlorophenyl)methyl]sulfanyl}-N,N-diethyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[(2-chlorophenyl)methyl]sulfanyl}-N,N-diethyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
2-{[(2-chlorophenyl)methyl]sulfanyl}-N,N-diethyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G858-0525 |
| Compound Name: | 2-{[(2-chlorophenyl)methyl]sulfanyl}-N,N-diethyl-3-(4-fluorophenyl)-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 496 |
| Molecular Formula: | C26 H23 Cl F N3 O2 S |
| Smiles: | CCN(CC)C(c1ccc2C(N(C(=Nc2c1)SCc1ccccc1[Cl])c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6638 |
| logD: | 4.6637 |
| logSw: | -4.8269 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.092 |
| InChI Key: | RFYAMPGCCVULRM-UHFFFAOYSA-N |