2-{[(4-chlorophenyl)methyl]sulfanyl}-3-(3-fluorophenyl)-7-(piperidine-1-carbonyl)quinazolin-4(3H)-one
Chemical Structure Depiction of
2-{[(4-chlorophenyl)methyl]sulfanyl}-3-(3-fluorophenyl)-7-(piperidine-1-carbonyl)quinazolin-4(3H)-one
2-{[(4-chlorophenyl)methyl]sulfanyl}-3-(3-fluorophenyl)-7-(piperidine-1-carbonyl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | G859-0022 |
| Compound Name: | 2-{[(4-chlorophenyl)methyl]sulfanyl}-3-(3-fluorophenyl)-7-(piperidine-1-carbonyl)quinazolin-4(3H)-one |
| Molecular Weight: | 508.01 |
| Molecular Formula: | C27 H23 Cl F N3 O2 S |
| Smiles: | C1CCN(CC1)C(c1ccc2C(N(C(=Nc2c1)SCc1ccc(cc1)[Cl])c1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.718 |
| logD: | 4.7179 |
| logSw: | -4.9582 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.808 |
| InChI Key: | DPVAQQNJRWTSTA-UHFFFAOYSA-N |