N-benzyl-3-(3,5-dimethylphenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
N-benzyl-3-(3,5-dimethylphenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
N-benzyl-3-(3,5-dimethylphenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G859-0141 |
| Compound Name: | N-benzyl-3-(3,5-dimethylphenyl)-N-methyl-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 533.69 |
| Molecular Formula: | C33 H31 N3 O2 S |
| Smiles: | Cc1cccc(CSC2=Nc3cc(ccc3C(N2c2cc(C)cc(C)c2)=O)C(N(C)Cc2ccccc2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.8153 |
| logD: | 6.811 |
| logSw: | -5.6314 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.31 |
| InChI Key: | QKDZHSLJJVCHCY-UHFFFAOYSA-N |