2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(3,5-dimethylphenyl)-N,N-diethyl-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(3,5-dimethylphenyl)-N,N-diethyl-4-oxo-3,4-dihydroquinazoline-7-carboxamide
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(3,5-dimethylphenyl)-N,N-diethyl-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G859-0176 |
| Compound Name: | 2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(3,5-dimethylphenyl)-N,N-diethyl-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 506.07 |
| Molecular Formula: | C28 H28 Cl N3 O2 S |
| Smiles: | CCN(CC)C(c1ccc2C(N(C(=Nc2c1)SCc1cccc(c1)[Cl])c1cc(C)cc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6667 |
| logD: | 5.6624 |
| logSw: | -5.8222 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 41.092 |
| InChI Key: | YDTGLTAJLUJDHR-UHFFFAOYSA-N |