N,N-diethyl-3-(4-methoxyphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Chemical Structure Depiction of
N,N-diethyl-3-(4-methoxyphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
N,N-diethyl-3-(4-methoxyphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide
Compound characteristics
| Compound ID: | G859-0276 |
| Compound Name: | N,N-diethyl-3-(4-methoxyphenyl)-2-{[(3-methylphenyl)methyl]sulfanyl}-4-oxo-3,4-dihydroquinazoline-7-carboxamide |
| Molecular Weight: | 487.62 |
| Molecular Formula: | C28 H29 N3 O3 S |
| Smiles: | CCN(CC)C(c1ccc2C(N(C(=Nc2c1)SCc1cccc(C)c1)c1ccc(cc1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.605 |
| logD: | 4.6048 |
| logSw: | -4.4741 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.635 |
| InChI Key: | HDTPITICEPJXET-UHFFFAOYSA-N |