6-[2-(2H-1,3-benzodioxol-5-yl)-2-oxoethyl]-2-phenyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Chemical Structure Depiction of
6-[2-(2H-1,3-benzodioxol-5-yl)-2-oxoethyl]-2-phenyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
6-[2-(2H-1,3-benzodioxol-5-yl)-2-oxoethyl]-2-phenyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Compound characteristics
| Compound ID: | G861-0030 |
| Compound Name: | 6-[2-(2H-1,3-benzodioxol-5-yl)-2-oxoethyl]-2-phenyl[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one |
| Molecular Weight: | 424.41 |
| Molecular Formula: | C24 H16 N4 O4 |
| Smiles: | C(C(c1ccc2c(c1)OCO2)=O)N1C(n2c(c3ccccc13)nc(c1ccccc1)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2587 |
| logD: | 4.2587 |
| logSw: | -4.5182 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 69.458 |
| InChI Key: | ILORCFVMFBXDCW-UHFFFAOYSA-N |