6-[(4-fluorophenyl)methyl]-2-(3-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Chemical Structure Depiction of
6-[(4-fluorophenyl)methyl]-2-(3-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
6-[(4-fluorophenyl)methyl]-2-(3-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Compound characteristics
| Compound ID: | G861-0039 |
| Compound Name: | 6-[(4-fluorophenyl)methyl]-2-(3-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one |
| Molecular Weight: | 384.41 |
| Molecular Formula: | C23 H17 F N4 O |
| Smiles: | Cc1cccc(c1)c1nc2c3ccccc3N(Cc3ccc(cc3)F)C(n2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.255 |
| logD: | 5.255 |
| logSw: | -5.1486 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.095 |
| InChI Key: | IJXSFYLYQBMCPP-UHFFFAOYSA-N |