6-[2-(3-chlorophenyl)-2-oxoethyl]-2-(4-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Chemical Structure Depiction of
6-[2-(3-chlorophenyl)-2-oxoethyl]-2-(4-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
6-[2-(3-chlorophenyl)-2-oxoethyl]-2-(4-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Compound characteristics
| Compound ID: | G861-0066 |
| Compound Name: | 6-[2-(3-chlorophenyl)-2-oxoethyl]-2-(4-methylphenyl)[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one |
| Molecular Weight: | 428.88 |
| Molecular Formula: | C24 H17 Cl N4 O2 |
| Smiles: | Cc1ccc(cc1)c1nc2c3ccccc3N(CC(c3cccc(c3)[Cl])=O)C(n2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5275 |
| logD: | 5.5275 |
| logSw: | -5.7237 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.342 |
| InChI Key: | WBKHWWGNFIXLTL-UHFFFAOYSA-N |