6-[2-(3-chlorophenyl)-2-oxoethyl]-2-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Chemical Structure Depiction of
6-[2-(3-chlorophenyl)-2-oxoethyl]-2-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
6-[2-(3-chlorophenyl)-2-oxoethyl]-2-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one
Compound characteristics
| Compound ID: | G861-0163 |
| Compound Name: | 6-[2-(3-chlorophenyl)-2-oxoethyl]-2-[2-(3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-8,9-dimethoxy[1,2,4]triazolo[1,5-c]quinazolin-5(6H)-one |
| Molecular Weight: | 520.97 |
| Molecular Formula: | C26 H25 Cl N6 O4 |
| Smiles: | Cc1cc(C)n(CCc2nc3c4cc(c(cc4N(CC(c4cccc(c4)[Cl])=O)C(n3n2)=O)OC)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.5293 |
| logD: | 3.5276 |
| logSw: | -3.9156 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 82.579 |
| InChI Key: | UAFNBRVCSOMSFZ-UHFFFAOYSA-N |