2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}-N-[3-(trifluoromethyl)phenyl]acetamide
2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | G862-0634 |
| Compound Name: | 2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 448.46 |
| Molecular Formula: | C22 H19 F3 N2 O3 S |
| Smiles: | COC1=CN(CC(Nc2cccc(c2)C(F)(F)F)=O)C(CSc2ccccc2)=CC1=O |
| Stereo: | ACHIRAL |
| logP: | 4.2454 |
| logD: | 4.2446 |
| logSw: | -4.3117 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.223 |
| InChI Key: | DOLHURQARMPZID-UHFFFAOYSA-N |