N-[(4-fluorophenyl)methyl]-2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}acetamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}acetamide
N-[(4-fluorophenyl)methyl]-2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}acetamide
Compound characteristics
| Compound ID: | G862-0635 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-{5-methoxy-4-oxo-2-[(phenylsulfanyl)methyl]pyridin-1(4H)-yl}acetamide |
| Molecular Weight: | 412.48 |
| Molecular Formula: | C22 H21 F N2 O3 S |
| Smiles: | COC1=CN(CC(NCc2ccc(cc2)F)=O)C(CSc2ccccc2)=CC1=O |
| Stereo: | ACHIRAL |
| logP: | 2.809 |
| logD: | 2.809 |
| logSw: | -3.282 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.545 |
| InChI Key: | PPJUXEOGNBBFNS-UHFFFAOYSA-N |