N-[(furan-2-yl)methyl]-2-[5-methoxy-2-{[(4-methylphenyl)sulfanyl]methyl}-4-oxopyridin-1(4H)-yl]acetamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-2-[5-methoxy-2-{[(4-methylphenyl)sulfanyl]methyl}-4-oxopyridin-1(4H)-yl]acetamide
N-[(furan-2-yl)methyl]-2-[5-methoxy-2-{[(4-methylphenyl)sulfanyl]methyl}-4-oxopyridin-1(4H)-yl]acetamide
Compound characteristics
| Compound ID: | G862-0838 |
| Compound Name: | N-[(furan-2-yl)methyl]-2-[5-methoxy-2-{[(4-methylphenyl)sulfanyl]methyl}-4-oxopyridin-1(4H)-yl]acetamide |
| Molecular Weight: | 398.48 |
| Molecular Formula: | C21 H22 N2 O4 S |
| Smiles: | Cc1ccc(cc1)SCC1=CC(C(=CN1CC(NCc1ccco1)=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.139 |
| logD: | 3.139 |
| logSw: | -3.2894 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.294 |
| InChI Key: | JDQTZUFHRVQLRE-UHFFFAOYSA-N |