2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(2-methoxyethyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Chemical Structure Depiction of
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(2-methoxyethyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(2-methoxyethyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one
Compound characteristics
| Compound ID: | G864-0172 |
| Compound Name: | 2-{[(3-chlorophenyl)methyl]sulfanyl}-3-(2-methoxyethyl)-3,5-dihydro-4H-pyrimido[5,4-b]indol-4-one |
| Molecular Weight: | 399.9 |
| Molecular Formula: | C20 H18 Cl N3 O2 S |
| Smiles: | COCCN1C(=Nc2c3ccccc3[nH]c2C1=O)SCc1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.065 |
| logD: | 4.065 |
| logSw: | -4.304 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.322 |
| InChI Key: | GSPKZJOCIHLGJJ-UHFFFAOYSA-N |