{4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl}[4-(trifluoromethyl)phenyl]methanone
Chemical Structure Depiction of
{4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl}[4-(trifluoromethyl)phenyl]methanone
{4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl}[4-(trifluoromethyl)phenyl]methanone
Compound characteristics
| Compound ID: | G868-0911 |
| Compound Name: | {4-[4-methyl-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]piperazin-1-yl}[4-(trifluoromethyl)phenyl]methanone |
| Molecular Weight: | 448.49 |
| Molecular Formula: | C22 H27 F3 N6 O |
| Smiles: | Cc1cc(nc(n1)N1CCN(CC1)C(c1ccc(cc1)C(F)(F)F)=O)N1CCN(C)CC1 |
| Stereo: | ACHIRAL |
| logP: | 3.5633 |
| logD: | 2.9933 |
| logSw: | -3.605 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 43.844 |
| InChI Key: | NVCDNLODJTWQLC-UHFFFAOYSA-N |