N-(4-{[4-(ethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methylbenzamide
Chemical Structure Depiction of
N-(4-{[4-(ethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methylbenzamide
N-(4-{[4-(ethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methylbenzamide
Compound characteristics
| Compound ID: | G869-0019 |
| Compound Name: | N-(4-{[4-(ethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methylbenzamide |
| Molecular Weight: | 361.45 |
| Molecular Formula: | C21 H23 N5 O |
| Smiles: | CCNc1cc(C)nc(Nc2ccc(cc2)NC(c2cccc(C)c2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.3128 |
| logD: | 4.1743 |
| logSw: | -4.2756 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.453 |
| InChI Key: | CTDYNZJUJUNOSD-UHFFFAOYSA-N |