N-(4-{[4-(diethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methoxybenzamide
Chemical Structure Depiction of
N-(4-{[4-(diethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methoxybenzamide
N-(4-{[4-(diethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methoxybenzamide
Compound characteristics
| Compound ID: | G869-0868 |
| Compound Name: | N-(4-{[4-(diethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-3-methoxybenzamide |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C23 H27 N5 O2 |
| Smiles: | CCN(CC)c1cc(C)nc(Nc2ccc(cc2)NC(c2cccc(c2)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.0649 |
| logD: | 5.0047 |
| logSw: | -4.7522 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.497 |
| InChI Key: | KUJCDCGPVKDLPK-UHFFFAOYSA-N |