4-bromo-N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-bromo-N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
4-bromo-N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G869-1201 |
| Compound Name: | 4-bromo-N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide |
| Molecular Weight: | 462.37 |
| Molecular Formula: | C19 H20 Br N5 O2 S |
| Smiles: | Cc1cc(nc(Nc2ccc(cc2)NS(c2ccc(cc2)[Br])(=O)=O)n1)N(C)C |
| Stereo: | ACHIRAL |
| logP: | 4.9593 |
| logD: | 3.6236 |
| logSw: | -4.6843 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.58 |
| InChI Key: | NWKKXXJHCBWWLV-UHFFFAOYSA-N |