N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-2,5-diethoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-2,5-diethoxybenzene-1-sulfonamide
N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-2,5-diethoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G869-1213 |
| Compound Name: | N-(4-{[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino}phenyl)-2,5-diethoxybenzene-1-sulfonamide |
| Molecular Weight: | 471.58 |
| Molecular Formula: | C23 H29 N5 O4 S |
| Smiles: | CCOc1ccc(c(c1)S(Nc1ccc(cc1)Nc1nc(C)cc(n1)N(C)C)(=O)=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 4.7565 |
| logD: | 3.4208 |
| logSw: | -4.4974 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.914 |
| InChI Key: | PMKARLRZSBEZLY-UHFFFAOYSA-N |