4-ethoxy-N-(4-{[4-methyl-6-(morpholin-4-yl)pyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-ethoxy-N-(4-{[4-methyl-6-(morpholin-4-yl)pyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
4-ethoxy-N-(4-{[4-methyl-6-(morpholin-4-yl)pyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G869-1330 |
| Compound Name: | 4-ethoxy-N-(4-{[4-methyl-6-(morpholin-4-yl)pyrimidin-2-yl]amino}phenyl)benzene-1-sulfonamide |
| Molecular Weight: | 469.56 |
| Molecular Formula: | C23 H27 N5 O4 S |
| Smiles: | CCOc1ccc(cc1)S(Nc1ccc(cc1)Nc1nc(C)cc(n1)N1CCOCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4304 |
| logD: | 4.3688 |
| logSw: | -4.1425 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.26 |
| InChI Key: | KZYYVKMLNSGBIM-UHFFFAOYSA-N |