N-(2-{[6-(4-methylphenyl)pyridazin-3-yl]oxy}ethyl)-2-phenylbutanamide
Chemical Structure Depiction of
N-(2-{[6-(4-methylphenyl)pyridazin-3-yl]oxy}ethyl)-2-phenylbutanamide
N-(2-{[6-(4-methylphenyl)pyridazin-3-yl]oxy}ethyl)-2-phenylbutanamide
Compound characteristics
| Compound ID: | G870-0146 |
| Compound Name: | N-(2-{[6-(4-methylphenyl)pyridazin-3-yl]oxy}ethyl)-2-phenylbutanamide |
| Molecular Weight: | 375.47 |
| Molecular Formula: | C23 H25 N3 O2 |
| Smiles: | CCC(C(NCCOc1ccc(c2ccc(C)cc2)nn1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7885 |
| logD: | 4.7874 |
| logSw: | -4.5169 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.283 |
| InChI Key: | RHXVOKCNRKEPOB-HXUWFJFHSA-N |