N-{2-[(6-phenylpyridazin-3-yl)oxy]ethyl}[1,1'-biphenyl]-4-sulfonamide
Chemical Structure Depiction of
N-{2-[(6-phenylpyridazin-3-yl)oxy]ethyl}[1,1'-biphenyl]-4-sulfonamide
N-{2-[(6-phenylpyridazin-3-yl)oxy]ethyl}[1,1'-biphenyl]-4-sulfonamide
Compound characteristics
| Compound ID: | G870-0539 |
| Compound Name: | N-{2-[(6-phenylpyridazin-3-yl)oxy]ethyl}[1,1'-biphenyl]-4-sulfonamide |
| Molecular Weight: | 431.51 |
| Molecular Formula: | C24 H21 N3 O3 S |
| Smiles: | C(COc1ccc(c2ccccc2)nn1)NS(c1ccc(cc1)c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.115 |
| logD: | 5.1148 |
| logSw: | -5.6281 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.356 |
| InChI Key: | LTCDMSXQZNETSS-UHFFFAOYSA-N |