methyl 4-[2-({1-[(2-methoxyphenyl)methyl]-1H-imidazol-2-yl}sulfanyl)acetamido]benzoate
Chemical Structure Depiction of
methyl 4-[2-({1-[(2-methoxyphenyl)methyl]-1H-imidazol-2-yl}sulfanyl)acetamido]benzoate
methyl 4-[2-({1-[(2-methoxyphenyl)methyl]-1H-imidazol-2-yl}sulfanyl)acetamido]benzoate
Compound characteristics
| Compound ID: | G877-0224 |
| Compound Name: | methyl 4-[2-({1-[(2-methoxyphenyl)methyl]-1H-imidazol-2-yl}sulfanyl)acetamido]benzoate |
| Molecular Weight: | 411.48 |
| Molecular Formula: | C21 H21 N3 O4 S |
| Smiles: | COC(c1ccc(cc1)NC(CSc1nccn1Cc1ccccc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5836 |
| logD: | 3.5831 |
| logSw: | -3.7555 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.012 |
| InChI Key: | OIVLSSUFHVWFTJ-UHFFFAOYSA-N |