N-(4-ethylphenyl)-2-(4-oxopyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-2-(4-oxopyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
N-(4-ethylphenyl)-2-(4-oxopyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide
Compound characteristics
| Compound ID: | G881-0045 |
| Compound Name: | N-(4-ethylphenyl)-2-(4-oxopyrido[3',2':4,5]thieno[3,2-d]pyrimidin-3(4H)-yl)acetamide |
| Molecular Weight: | 364.42 |
| Molecular Formula: | C19 H16 N4 O2 S |
| Smiles: | CCc1ccc(cc1)NC(CN1C=Nc2c3cccnc3sc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1771 |
| logD: | 3.1771 |
| logSw: | -3.1985 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.389 |
| InChI Key: | ONWLTFKDJZHOBS-UHFFFAOYSA-N |