3-(4-methoxyphenyl)-N-{[1-(4-methylbenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}propanamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-N-{[1-(4-methylbenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}propanamide
3-(4-methoxyphenyl)-N-{[1-(4-methylbenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}propanamide
Compound characteristics
| Compound ID: | G883-0319 |
| Compound Name: | 3-(4-methoxyphenyl)-N-{[1-(4-methylbenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}propanamide |
| Molecular Weight: | 428.53 |
| Molecular Formula: | C27 H28 N2 O3 |
| Smiles: | Cc1ccc(cc1)C(N1CCc2cc(CNC(CCc3ccc(cc3)OC)=O)ccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4947 |
| logD: | 4.4947 |
| logSw: | -4.2847 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.661 |
| InChI Key: | XUSOKRRAWJIEGU-UHFFFAOYSA-N |