N-{[1-(4-fluorobenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-2-{[(4-fluorophenyl)methyl]sulfanyl}acetamide
Chemical Structure Depiction of
N-{[1-(4-fluorobenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-2-{[(4-fluorophenyl)methyl]sulfanyl}acetamide
N-{[1-(4-fluorobenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-2-{[(4-fluorophenyl)methyl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | G883-0865 |
| Compound Name: | N-{[1-(4-fluorobenzoyl)-2,3-dihydro-1H-indol-5-yl]methyl}-2-{[(4-fluorophenyl)methyl]sulfanyl}acetamide |
| Molecular Weight: | 452.52 |
| Molecular Formula: | C25 H22 F2 N2 O2 S |
| Smiles: | C1CN(C(c2ccc(cc2)F)=O)c2ccc(CNC(CSCc3ccc(cc3)F)=O)cc12 |
| Stereo: | ACHIRAL |
| logP: | 4.3519 |
| logD: | 4.3519 |
| logSw: | -4.3107 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.117 |
| InChI Key: | YPLAJHNOJPYAHK-UHFFFAOYSA-N |