ethyl 5-amino-1-{4-[(3-methylbutyl)carbamoyl]phenyl}-1H-pyrazole-4-carboxylate
Chemical Structure Depiction of
ethyl 5-amino-1-{4-[(3-methylbutyl)carbamoyl]phenyl}-1H-pyrazole-4-carboxylate
ethyl 5-amino-1-{4-[(3-methylbutyl)carbamoyl]phenyl}-1H-pyrazole-4-carboxylate
Compound characteristics
| Compound ID: | G892-0130 |
| Compound Name: | ethyl 5-amino-1-{4-[(3-methylbutyl)carbamoyl]phenyl}-1H-pyrazole-4-carboxylate |
| Molecular Weight: | 344.41 |
| Molecular Formula: | C18 H24 N4 O3 |
| Smiles: | CCOC(c1cnn(c2ccc(cc2)C(NCCC(C)C)=O)c1N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8407 |
| logD: | 2.8407 |
| logSw: | -3.2965 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.835 |
| InChI Key: | FLVGKWZWSXNOKS-UHFFFAOYSA-N |