1-[3-(4-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
Chemical Structure Depiction of
1-[3-(4-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
1-[3-(4-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G902-0663 |
| Compound Name: | 1-[3-(4-methoxyphenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N-{[4-(methylsulfanyl)phenyl]methyl}piperidine-4-carboxamide |
| Molecular Weight: | 489.6 |
| Molecular Formula: | C26 H27 N5 O3 S |
| Smiles: | COc1ccc(cc1)c1c2c(ncnc2on1)N1CCC(CC1)C(NCc1ccc(cc1)SC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3133 |
| logD: | 4.3133 |
| logSw: | -4.3168 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.492 |
| InChI Key: | UOQZMVRMSHHJEB-UHFFFAOYSA-N |