N-(3-methylbutyl)-4-(3,6,6-trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)benzamide
Chemical Structure Depiction of
N-(3-methylbutyl)-4-(3,6,6-trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)benzamide
N-(3-methylbutyl)-4-(3,6,6-trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)benzamide
Compound characteristics
| Compound ID: | G904-0454 |
| Compound Name: | N-(3-methylbutyl)-4-(3,6,6-trimethyl-4-oxo-4,5,6,7-tetrahydro-1H-indazol-1-yl)benzamide |
| Molecular Weight: | 367.49 |
| Molecular Formula: | C22 H29 N3 O2 |
| Smiles: | CC(C)CCNC(c1ccc(cc1)n1c2CC(C)(C)CC(c2c(C)n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2004 |
| logD: | 3.2004 |
| logSw: | -3.6029 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.336 |
| InChI Key: | XMENDLDWZLPJHW-UHFFFAOYSA-N |