N~2~-(dimethylsulfamoyl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}-N~2~-(4-methylphenyl)glycinamide
Chemical Structure Depiction of
N~2~-(dimethylsulfamoyl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}-N~2~-(4-methylphenyl)glycinamide
N~2~-(dimethylsulfamoyl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}-N~2~-(4-methylphenyl)glycinamide
Compound characteristics
| Compound ID: | G906-0630 |
| Compound Name: | N~2~-(dimethylsulfamoyl)-N-{3-[4-(4-fluorophenyl)piperazin-1-yl]propyl}-N~2~-(4-methylphenyl)glycinamide |
| Molecular Weight: | 491.63 |
| Molecular Formula: | C24 H34 F N5 O3 S |
| Smiles: | Cc1ccc(cc1)N(CC(NCCCN1CCN(CC1)c1ccc(cc1)F)=O)S(N(C)C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2802 |
| logD: | 1.6941 |
| logSw: | -2.9326 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.707 |
| InChI Key: | UPVGBXNZZYHWDS-UHFFFAOYSA-N |