N~2~-(dimethylsulfamoyl)-N~2~-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]glycinamide
Chemical Structure Depiction of
N~2~-(dimethylsulfamoyl)-N~2~-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]glycinamide
N~2~-(dimethylsulfamoyl)-N~2~-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]glycinamide
Compound characteristics
| Compound ID: | G906-0961 |
| Compound Name: | N~2~-(dimethylsulfamoyl)-N~2~-(4-fluorophenyl)-N-[(4-methylphenyl)methyl]glycinamide |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C18 H22 F N3 O3 S |
| Smiles: | Cc1ccc(CNC(CN(c2ccc(cc2)F)S(N(C)C)(=O)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.3914 |
| logD: | 2.3914 |
| logSw: | -2.8833 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.622 |
| InChI Key: | XZHWZMUWXDQJOU-UHFFFAOYSA-N |