N-benzyl-6-(2-methoxyphenyl)-3-(4-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
N-benzyl-6-(2-methoxyphenyl)-3-(4-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
N-benzyl-6-(2-methoxyphenyl)-3-(4-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | G923-0160 |
| Compound Name: | N-benzyl-6-(2-methoxyphenyl)-3-(4-methoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 464.52 |
| Molecular Formula: | C28 H24 N4 O3 |
| Smiles: | COc1ccc(cc1)c1c2c(cc(c3ccccc3OC)nc2n[nH]1)C(NCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5558 |
| logD: | 5.555 |
| logSw: | -5.7231 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.471 |
| InChI Key: | KHXKTXYGFGDSKJ-UHFFFAOYSA-N |