3-(4-fluorophenyl)-6-(4-methylphenyl)-N-{[4-(methylsulfanyl)phenyl]methyl}-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Chemical Structure Depiction of
3-(4-fluorophenyl)-6-(4-methylphenyl)-N-{[4-(methylsulfanyl)phenyl]methyl}-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
3-(4-fluorophenyl)-6-(4-methylphenyl)-N-{[4-(methylsulfanyl)phenyl]methyl}-2H-pyrazolo[3,4-b]pyridine-4-carboxamide
Compound characteristics
| Compound ID: | G923-0449 |
| Compound Name: | 3-(4-fluorophenyl)-6-(4-methylphenyl)-N-{[4-(methylsulfanyl)phenyl]methyl}-2H-pyrazolo[3,4-b]pyridine-4-carboxamide |
| Molecular Weight: | 482.58 |
| Molecular Formula: | C28 H23 F N4 O S |
| Smiles: | Cc1ccc(cc1)c1cc(C(NCc2ccc(cc2)SC)=O)c2c(n1)n[nH]c2c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 7.2099 |
| logD: | 7.2091 |
| logSw: | -5.8494 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.297 |
| InChI Key: | MCYWORXBAPIFPG-UHFFFAOYSA-N |