N~4~-(3-fluorophenyl)-1-phenyl-N~6~-(prop-2-en-1-yl)-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
Chemical Structure Depiction of
N~4~-(3-fluorophenyl)-1-phenyl-N~6~-(prop-2-en-1-yl)-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
N~4~-(3-fluorophenyl)-1-phenyl-N~6~-(prop-2-en-1-yl)-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine
Compound characteristics
| Compound ID: | G932-0661 |
| Compound Name: | N~4~-(3-fluorophenyl)-1-phenyl-N~6~-(prop-2-en-1-yl)-1H-pyrazolo[3,4-d]pyrimidine-4,6-diamine |
| Molecular Weight: | 360.39 |
| Molecular Formula: | C20 H17 F N6 |
| Smiles: | C=CCNc1nc(c2cnn(c3ccccc3)c2n1)Nc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 4.8855 |
| logD: | 4.8837 |
| logSw: | -4.9056 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.271 |
| InChI Key: | AKSXLUIELYNKQB-UHFFFAOYSA-N |