N-(3-ethylphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
Chemical Structure Depiction of
N-(3-ethylphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
N-(3-ethylphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide
Compound characteristics
| Compound ID: | G933-0197 |
| Compound Name: | N-(3-ethylphenyl)-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxamide |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C18 H17 N3 O2 |
| Smiles: | CCc1cccc(c1)NC(C1C(N(C)c2ccccc2N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7148 |
| logD: | 2.7145 |
| logSw: | -3.2537 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.578 |
| InChI Key: | FFNUHCFQSMFDKV-UHFFFAOYSA-N |