3-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-1-methylquinoxalin-2(1H)-one
Chemical Structure Depiction of
3-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-1-methylquinoxalin-2(1H)-one
3-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-1-methylquinoxalin-2(1H)-one
Compound characteristics
| Compound ID: | G933-0208 |
| Compound Name: | 3-[4-(2,4-dimethylphenyl)piperazine-1-carbonyl]-1-methylquinoxalin-2(1H)-one |
| Molecular Weight: | 376.46 |
| Molecular Formula: | C22 H24 N4 O2 |
| Smiles: | Cc1ccc(c(C)c1)N1CCN(CC1)C(C1C(N(C)c2ccccc2N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1072 |
| logD: | 3.1072 |
| logSw: | -3.2477 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 43.095 |
| InChI Key: | DZHOSRXKEFBGCJ-UHFFFAOYSA-N |