ethyl 4-{3-[(3,4-difluorophenyl)carbamoyl]piperidine-1-sulfonyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-{3-[(3,4-difluorophenyl)carbamoyl]piperidine-1-sulfonyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
ethyl 4-{3-[(3,4-difluorophenyl)carbamoyl]piperidine-1-sulfonyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | G937-1739 |
| Compound Name: | ethyl 4-{3-[(3,4-difluorophenyl)carbamoyl]piperidine-1-sulfonyl}-1,2,5-trimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 483.53 |
| Molecular Formula: | C22 H27 F2 N3 O5 S |
| Smiles: | CCOC(c1c(c(C)n(C)c1C)S(N1CCCC(C1)C(Nc1ccc(c(c1)F)F)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2219 |
| logD: | 2.0702 |
| logSw: | -2.924 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.507 |
| InChI Key: | ASKRQURZGQZXFT-HNNXBMFYSA-N |